![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | A Dutchman Capturing a Feroci-7d35 | 2021-09-29 07:44 | 60K | |
![[IMG]](/icons/image2.gif) | A Dutchman Capturing a Feroci-7d35d761b3652038.jpg | 2021-10-06 07:44 | 60K | |
![[IMG]](/icons/image2.gif) | A Dutchman Capturing a Feroci-b659 | 2021-09-29 07:44 | 60K | |
![[IMG]](/icons/image2.gif) | A Dutchman Capturing a Feroci-b65966228cd8828a.jpg | 2021-10-06 07:44 | 60K | |
![[IMG]](/icons/image2.gif) | Apricot in the Night Nap Danc-e002 | 2021-09-29 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | Apricot in the Night Nap Danc-e002b6827048c660.jpg | 2021-10-06 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | Artist-goes-to-jail-ehon-sign-497e | 2021-09-29 07:44 | 640K | |
![[IMG]](/icons/image2.gif) | Artist-goes-to-jail-ehon-sign-497eb0578529ed60.jpg | 2021-10-06 07:44 | 640K | |
![[IMG]](/icons/image2.gif) | Battle of Frogs, 1864-1-2009-09-01 | 2021-09-29 07:44 | 102K | |
![[IMG]](/icons/image2.gif) | Battle of Frogs, 1864-1-2009-09-01T05_11_12Z.jpg | 2021-10-06 07:44 | 102K | |
![[IMG]](/icons/image2.gif) | Battle of Frogs, 1864.jpg | 2021-10-06 07:44 | 102K | |
![[IMG]](/icons/image2.gif) | Cartoons-1-2009-09-01T05_12_07Z.jp | 2021-09-29 07:44 | 55K | |
![[IMG]](/icons/image2.gif) | Cartoons-1-2009-09-01T05_12_07Z.jpeg | 2021-10-06 07:44 | 55K | |
![[IMG]](/icons/image2.gif) | Cartoons.jpeg | 2021-10-06 07:44 | 55K | |
![[IMG]](/icons/image2.gif) | Comic One Hundred Turns of th-28d7 | 2021-09-29 07:44 | 103K | |
![[IMG]](/icons/image2.gif) | Comic One Hundred Turns of th-28d761826bde8e87.jpg | 2021-10-06 07:44 | 103K | |
![[IMG]](/icons/image2.gif) | Comic One Hundred Turns of th-dad5 | 2021-09-29 07:44 | 103K | |
![[IMG]](/icons/image2.gif) | Comic One Hundred Turns of th-dad5e9c9a1244904.jpg | 2021-10-06 07:44 | 103K | |
![[IMG]](/icons/image2.gif) | Conder-Kyosai-Seals-1-web-1-2-2cc1 | 2021-09-29 07:44 | 41K | |
![[IMG]](/icons/image2.gif) | Conder-Kyosai-Seals-1-web-1-2-2cc186ce0a8713b1.jpg | 2021-10-06 07:44 | 41K | |
![[IMG]](/icons/image2.gif) | Conder-Kyosai-Seals-1-web.jpg | 2021-10-06 07:44 | 41K | |
![[IMG]](/icons/image2.gif) | Deichu no hasu from the serie-f1d9 | 2021-09-29 07:44 | 19K | |
![[IMG]](/icons/image2.gif) | Deichu no hasu from the serie-f1d95aa3685fa229.jpg | 2021-10-06 07:44 | 19K | |
![[IMG]](/icons/image2.gif) | Drumming God is Thunder God f-d8d3 | 2021-09-29 07:44 | 11K | |
![[IMG]](/icons/image2.gif) | Drumming God is Thunder God f-d8d3acc6ed6219f0.jpg | 2021-10-06 07:44 | 11K | |
![[IMG]](/icons/image2.gif) | Gyosai-150x63-web.jpg | 2021-10-06 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Gyosai-200x76-web.jpg | 2021-10-06 07:44 | 10K | |
![[IMG]](/icons/image2.gif) | Gyosai-Hyakuzu-Akuji-senri-o--e3f6 | 2021-09-29 07:44 | 9.7K | |
![[IMG]](/icons/image2.gif) | Gyosai-Hyakuzu-Akuji-senri-o--e3f670db5e041503.jpg | 2021-10-06 07:44 | 9.7K | |
![[IMG]](/icons/image2.gif) | Gyosai-ga-mfa-200x86-web.jpg | 2021-10-06 07:44 | 9.9K | |
![[IMG]](/icons/image2.gif) | Joku-Kyosai-zu-200x40-web.jpg | 2021-10-06 07:44 | 5.7K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-seventh-month.--585c | 2021-09-29 07:44 | 16K | |
![[IMG]](/icons/image2.gif) | Kunichika-The-seventh-month.--585cf3e28c510c43.jpg | 2021-10-06 07:44 | 16K | |
![[IMG]](/icons/image2.gif) | Kyosai-2-mfa-150x81-web.jpg | 2021-10-06 07:44 | 7.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-3-mfa-150x57-web.jpg | 2021-10-06 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-150x86-web.jpg | 2021-10-06 07:44 | 7.6K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-2a35 | 2021-09-29 07:44 | 6.0K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-2a353c436002fbef.jpg | 2021-10-06 07:44 | 6.0K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-5ed9 | 2021-09-29 07:44 | 4.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-5ed961a592019dfd.jpg | 2021-10-06 07:44 | 4.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-9e0a | 2021-09-29 07:44 | 13K | |
![[IMG]](/icons/image2.gif) | Kyosai-Bell-ring-cricket-from-9e0add049c3c5f81.jpg | 2021-10-06 07:44 | 13K | |
![[IMG]](/icons/image2.gif) | Kyosai-Congratulations-on-mar-28dd | 2021-09-29 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Congratulations-on-mar-28dd0ac6001840b1.jpg | 2021-10-06 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Congratulations-on-mar-be45 | 2021-09-29 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Congratulations-on-mar-be455d10150f9c18.jpg | 2021-10-06 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Kyosai-Demon-of-Ibaraki-ihl-c-b26a | 2021-09-29 07:44 | 11K | |
![[IMG]](/icons/image2.gif) | Kyosai-Demon-of-Ibaraki-ihl-c-b26a21c09909050b.jpg | 2021-10-06 07:44 | 11K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Front-Faming-Man-1043 | 2021-09-29 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Front-Faming-Man-1043514ba3554c6d.jpg | 2021-10-06 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Front-Faming-Man-fc9f | 2021-09-29 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Front-Faming-Man-fc9f0eac403d39c3.jpg | 2021-10-06 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Laocoon-ihl-cat--a2ea | 2021-09-29 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Laocoon-ihl-cat--a2eab48daf5c19bf.jpg | 2021-10-06 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Laocoon-ihl-cat--d8f3 | 2021-09-29 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Laocoon-ihl-cat--d8f3a007bd3ffd08.jpg | 2021-10-06 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Learning-of-Pain-afe2 | 2021-09-29 07:44 | 82K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Learning-of-Pain-afe26155a1b4ddbc.jpg | 2021-10-06 07:44 | 82K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Learning-of-Painting- | 2021-09-29 07:44 | 82K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Learning-of-Painting-web.jpg | 2021-10-06 07:44 | 82K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--8fbd | 2021-09-29 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--8fbd2bbb769aca61.jpg | 2021-10-06 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--45b3 | 2021-09-29 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--45b3384d800f2075.jpg | 2021-10-06 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--f6cd | 2021-09-29 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-Rear-Facing-Man--f6cdca5e7ad68d34.jpg | 2021-10-06 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Movement-of--75bf | 2021-09-29 07:44 | 69K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Movement-of--75bf8142d297b079.jpg | 2021-10-06 07:44 | 69K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Movement-of-Paint | 2021-09-29 07:44 | 69K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Movement-of-Painting-web.jpg | 2021-10-06 07:44 | 69K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Secret-of-Dr-8364 | 2021-09-29 07:44 | 33K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Secret-of-Dr-8364bff6a1af7804.jpg | 2021-10-06 07:44 | 33K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Secret-of-Drawing | 2021-09-29 07:44 | 33K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-The-Secret-of-Drawing-Man-web.jpg | 2021-10-06 07:44 | 33K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-cover-volume-1-w-5bc6 | 2021-09-29 07:44 | 32K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-cover-volume-1-w-5bc6404a18041436.jpg | 2021-10-06 07:44 | 32K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-cover-volume-1-web.jp | 2021-09-29 07:44 | 32K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-cover-volume-1-web.jpg | 2021-10-06 07:44 | 32K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-drawing-after-So-69f3 | 2021-09-29 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-drawing-after-So-69f3382ef8fa4e1d.jpg | 2021-10-06 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-drawing-after-Sok-716 | 2021-09-29 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-drawing-after-Sok-71670c3e6f81ac1.jpg | 2021-10-06 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-volume-1_Page_02-643d | 2021-09-29 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-volume-1_Page_02-643da47e024413cb.jpg | 2021-10-06 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-volume-1_Page_02-web.jpg | 2021-10-06 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | Kyosai-Gadan-volume-1_Page_02-web_ | 2021-09-29 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Ningen-banji-S-1399 | 2021-09-29 07:45 | 7.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Ningen-banji-S-13997514219f5ca1.jpg | 2021-10-06 07:44 | 7.2K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Otafuku-ihl-.jpg | 2021-10-06 07:44 | 14K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Otsue-no-tawam-9885 | 2021-09-29 07:45 | 12K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Otsue-no-tawam-98851e1107f439e4.jpg | 2021-10-06 07:44 | 12K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Saka-ni-kuruma-ffef | 2021-09-29 07:45 | 12K | |
![[IMG]](/icons/image2.gif) | Kyosai-Hyakuzu-Saka-ni-kuruma-ffef24318ed44921.jpg | 2021-10-06 07:44 | 12K | |
![[IMG]](/icons/image2.gif) | Kyosai-figure-silouette-and-l-4b7a | 2021-09-29 07:44 | 5.4K | |
![[IMG]](/icons/image2.gif) | Kyosai-figure-silouette-and-l-4b7ac8fb931a3aa2.jpg | 2021-10-06 07:44 | 5.4K | |
![[IMG]](/icons/image2.gif) | Kyosai-ga-MFA-150x74-web.jpg | 2021-10-06 07:44 | 6.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-ga-with-unread-seal-200x71- | 2021-09-29 07:44 | 8.1K | |
![[IMG]](/icons/image2.gif) | Kyosai-ga-with-unread-seal-200x71-web.jpg | 2021-10-06 07:44 | 8.1K | |
![[IMG]](/icons/image2.gif) | Kyosai-hitsu-mfa-150x59.jpg | 2021-10-06 07:44 | 4.9K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Kappa-no-he-ih-7bcd | 2021-09-29 07:44 | 7.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Kappa-no-he-ih-7bcd480a74780471.jpg | 2021-10-06 07:44 | 7.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Mi-no-naru-ki--677d | 2021-09-29 07:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Mi-no-naru-ki--677d691e6b63b8cd.jpg | 2021-10-06 07:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Otsue-no-azuma-beaf | 2021-09-29 07:45 | 9.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Otsue-no-azuma-beaffb128ceb3a06.jpg | 2021-10-06 07:44 | 9.5K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Sho-no-daiteng-1210 | 2021-09-29 07:45 | 9.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-hyakuzu-Sho-no-daiteng-1210ee4d10848fb6.jpg | 2021-10-06 07:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | Kyosai-mfa-150x70-web.jpg | 2021-10-06 07:44 | 7.8K | |
![[IMG]](/icons/image2.gif) | Kyosai Dumpling IHL Cat 1387 thumb | 2021-09-29 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | Kyosai Dumpling IHL Cat 1387 thumb web.jpg | 2021-10-06 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | KyosaiFloweronWitheredTree ihl2080 | 2021-09-29 07:45 | 15K | |
![[IMG]](/icons/image2.gif) | KyosaiFloweronWitheredTree ihl2080 thumb web.jpg | 2021-10-06 07:44 | 15K | |
![[IMG]](/icons/image2.gif) | Kyosai unread from the series-9b99 | 2021-09-29 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | Kyosai unread from the series-9b994a37ffe27418.jpg | 2021-10-06 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | MFA1.jpg | 2021-10-06 07:44 | 6.8K | |
![[IMG]](/icons/image2.gif) | MFA2.jpg | 2021-10-06 07:44 | 5.5K | |
![[IMG]](/icons/image2.gif) | MFA3.jpg | 2021-10-06 07:44 | 11K | |
![[IMG]](/icons/image2.gif) | MFA4.jpg | 2021-10-06 07:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | Motome-in-ojite-Seisei-Kyosai-44c7 | 2021-09-29 07:45 | 9.9K | |
![[IMG]](/icons/image2.gif) | Motome-in-ojite-Seisei-Kyosai-44c70ffc88aaa6e4.jpg | 2021-10-06 07:44 | 9.9K | |
![[IMG]](/icons/image2.gif) | Motome-ni-ojite-Seisei-Kyosai-4176 | 2021-09-29 07:45 | 7.5K | |
![[IMG]](/icons/image2.gif) | Motome-ni-ojite-Seisei-Kyosai-4176658513a07de1.jpg | 2021-10-06 07:44 | 7.5K | |
![[IMG]](/icons/image2.gif) | NIneStagesofDeath719wweb.jpg | 2021-10-06 07:44 | 56K | |
![[IMG]](/icons/image2.gif) | Nyoku-Kyosai-with-Mankokubi-Ny-899 | 2021-09-29 07:45 | 8.1K | |
![[IMG]](/icons/image2.gif) | Nyoku-Kyosai-with-Mankokubi-Ny-8998dee67137f80.jpg | 2021-10-06 07:44 | 8.1K | |
![[IMG]](/icons/image2.gif) | Ofuku Coiffeur Holes in Their-a49b | 2021-09-29 07:45 | 18K | |
![[IMG]](/icons/image2.gif) | Ofuku Coiffeur Holes in Their-a49b2552b45ef7ed.jpg | 2021-10-06 07:44 | 18K | |
![[IMG]](/icons/image2.gif) | Oju-Chikamaro--mfa-150x73-web.jpg | 2021-10-06 07:44 | 6.2K | |
![[IMG]](/icons/image2.gif) | Oju-Chikamaro-150x61-web.jpg | 2021-10-06 07:44 | 4.7K | |
![[IMG]](/icons/image2.gif) | Oju-Chikamaro-mfa-150x61-web.jpg | 2021-10-06 07:44 | 6.0K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Chikamaro-mfa-150x62-we | 2021-09-29 07:45 | 7.1K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Chikamaro-mfa-150x62-web.jpg | 2021-10-06 07:44 | 7.1K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosa-mfa-horizontal-20 | 2021-09-29 07:45 | 6.3K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosa-mfa-horizontal-200x43-web.jpg | 2021-10-06 07:44 | 6.3K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-150x57-web.j | 2021-09-29 07:45 | 4.7K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-150x57-web.jpg | 2021-10-06 07:44 | 4.7K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-150x65-web.j | 2021-09-29 07:45 | 6.9K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-150x65-web.jpg | 2021-10-06 07:44 | 6.9K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-200x46-web.j | 2021-09-29 07:45 | 5.4K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-200x46-web.jpg | 2021-10-06 07:44 | 5.4K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-200x69-web.j | 2021-09-29 07:45 | 8.8K | |
![[IMG]](/icons/image2.gif) | Oju-Seisei-Kyosai-mfa-200x69-web.jpg | 2021-10-06 07:44 | 8.8K | |
![[IMG]](/icons/image2.gif) | Oju-seisei-kyosai-brmus-200x60-web | 2021-09-29 07:45 | 8.3K | |
![[IMG]](/icons/image2.gif) | Oju-seisei-kyosai-brmus-200x60-web.jpg | 2021-10-06 07:44 | 8.3K | |
![[IMG]](/icons/image2.gif) | Oju-seisei-kyosai-sho-brmus-150x55 | 2021-09-29 07:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | Oju-seisei-kyosai-sho-brmus-150x55-web.jpg | 2021-10-06 07:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | Repelling the Mongol Pirate S-1edd | 2021-09-29 07:45 | 95K | |
![[IMG]](/icons/image2.gif) | Repelling the Mongol Pirate S-1edd6e2cba1db73f.jpg | 2021-10-06 07:44 | 95K | |
![[IMG]](/icons/image2.gif) | Repelling the Mongol Pirate Ships 1863.jpg | 2021-10-06 07:44 | 95K | |
![[IMG]](/icons/image2.gif) | Repelling the Mongol Pirate Ships_ | 2021-09-29 07:45 | 95K | |
![[IMG]](/icons/image2.gif) | Ritsumeikan-Seisei-kyosai-giga-200 | 2021-09-29 07:45 | 7.4K | |
![[IMG]](/icons/image2.gif) | Ritsumeikan-Seisei-kyosai-giga-200x45-web.jpg | 2021-10-06 07:44 | 7.4K | |
![[IMG]](/icons/image2.gif) | Ritsumeikan-oju-----150x60-web.jpg | 2021-10-06 07:44 | 5.4K | |
![[IMG]](/icons/image2.gif) | Ritsumeikan-oju-chikamaro-200-x75- | 2021-09-29 07:45 | 10K | |
![[IMG]](/icons/image2.gif) | Ritsumeikan-oju-chikamaro-200-x75-web.jpg | 2021-10-06 07:44 | 10K | |
![[IMG]](/icons/image2.gif) | Seals Josiah Conder legend 1800w w | 2021-09-29 07:45 | 1.2M | |
![[IMG]](/icons/image2.gif) | Seals Josiah Conder legend 1800w web.jpg | 2021-10-06 07:44 | 1.2M | |
![[IMG]](/icons/image2.gif) | Seals from Josiah Conder 1800w web | 2021-09-29 07:45 | 529K | |
![[IMG]](/icons/image2.gif) | Seals from Josiah Conder 1800w web.jpg | 2021-10-06 07:44 | 529K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-giga-mfa-200x132-web | 2021-09-29 07:45 | 12K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-giga-mfa-200x132-web.jpg | 2021-10-06 07:44 | 12K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-mfa-150x59-web.jpg | 2021-10-06 07:44 | 6.5K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-mfa-150x133-web.jpg | 2021-10-06 07:44 | 9.9K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-mfa-200x57-web.jpg | 2021-10-06 07:44 | 7.0K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-nyudo-with-Seis-2738 | 2021-09-29 07:45 | 7.8K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-nyudo-with-Seis-2738a798c6c863b1.jpg | 2021-10-06 07:44 | 7.8K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-with-Kyosai-Gak-e63e | 2021-09-29 07:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-with-Kyosai-Gak-e63e569ce2619199.jpg | 2021-10-06 07:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-with-Toiku-seal-brmu | 2021-09-29 07:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | Seisei-Kyosai-with-Toiku-seal-brmus-200x55-web.jpg | 2021-10-06 07:44 | 7.7K | |
![[IMG]](/icons/image2.gif) | Shojo-Gyosai-brmus-150x64-web.jpg | 2021-10-06 07:44 | 4.3K | |
![[IMG]](/icons/image2.gif) | Shojo-Gyosai-mfa-150x65-web.jpg | 2021-10-06 07:44 | 5.6K | |
![[IMG]](/icons/image2.gif) | Shojo-Gyosai-mfa-200x82-web-1-565d | 2021-09-29 07:45 | 8.9K | |
![[IMG]](/icons/image2.gif) | Shojo-Gyosai-mfa-200x82-web-1-565d9e38c9fc661c.jpg | 2021-10-06 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Shojo-Gyosai-mfa-200x82-web.jpg | 2021-10-06 07:44 | 8.9K | |
![[IMG]](/icons/image2.gif) | Shojo-Kyosai-200x70-web.jpg | 2021-10-06 07:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | Shojo-Kyosai-brmus-200x67-web.jpg | 2021-10-06 07:44 | 8.2K | |
![[IMG]](/icons/image2.gif) | Shojo-Kyosai-with-Joku-Kyosai-de50 | 2021-09-29 07:45 | 7.3K | |
![[IMG]](/icons/image2.gif) | Shojo-Kyosai-with-Joku-Kyosai-de50a2575dbf98d5.jpg | 2021-10-06 07:44 | 7.3K | |
![[IMG]](/icons/image2.gif) | Shosho-Gyosai-200x56-web.jpg | 2021-10-06 07:44 | 8.5K | |
![[IMG]](/icons/image2.gif) | Shosho-Kyosai-150x63-web.jpg | 2021-10-06 07:44 | 5.4K | |
![[IMG]](/icons/image2.gif) | Shosho-Kyosai-200x72-web.jpg | 2021-10-06 07:44 | 7.4K | |
![[IMG]](/icons/image2.gif) | Shoshuosai-Toilku-ga-with-seal-200 | 2021-09-29 07:45 | 6.7K | |
![[IMG]](/icons/image2.gif) | Shoshuosai-Toilku-ga-with-seal-200x59-web.jpg | 2021-10-06 07:44 | 6.7K | |
![[IMG]](/icons/image2.gif) | Sitting on Her Husband, Plast-2123 | 2021-09-29 07:45 | 16K | |
![[IMG]](/icons/image2.gif) | Sitting on Her Husband, Plast-2123aefab496a187.jpg | 2021-10-06 07:44 | 16K | |
![[IMG]](/icons/image2.gif) | Standing Screen of a Tiger 18-a6e4 | 2021-09-29 07:45 | 25K | |
![[IMG]](/icons/image2.gif) | Standing Screen of a Tiger 18-a6e400c33619f8fb.jpg | 2021-10-06 07:44 | 25K | |
![[IMG]](/icons/image2.gif) | Standing Screen of a Tiger 1878.jp | 2021-09-29 07:45 | 25K | |
![[IMG]](/icons/image2.gif) | Standing Screen of a Tiger 1878.jpg | 2021-10-06 07:44 | 25K | |
![[IMG]](/icons/image2.gif) | The warrior Fishes expelling -d790 | 2021-09-29 07:45 | 101K | |
![[IMG]](/icons/image2.gif) | The warrior Fishes expelling -d790e4affa3f0100.jpg | 2021-10-06 07:44 | 101K | |
![[IMG]](/icons/image2.gif) | The warrior Fishes expelling -df11 | 2021-09-29 07:45 | 101K | |
![[IMG]](/icons/image2.gif) | The warrior Fishes expelling -df110e1cdde8e0d1.jpg | 2021-10-06 07:44 | 101K | |
![[IMG]](/icons/image2.gif) | Watonai as a famous toy maker-5e62 | 2021-09-29 07:45 | 16K | |
![[IMG]](/icons/image2.gif) | Watonai as a famous toy maker-5e62600e6d8f438b.jpg | 2021-10-06 07:44 | 16K | |
![[IMG]](/icons/image2.gif) | Watonai famous toy maker ihl -b1ab | 2021-09-29 07:45 | 16K | |
![[IMG]](/icons/image2.gif) | Watonai famous toy maker ihl -b1ab8eb72beb2e3c.jpg | 2021-10-06 07:44 | 16K | |
![[TXT]](/icons/text.gif) | a-sweet-pastry-into-the-open-mout- | 2021-09-29 07:44 | 543K | |
![[TXT]](/icons/text.gif) | a-sweet-pastry-into-the-open-mout-fb1e11d6b3ccfd50.html | 2021-10-06 07:44 | 542K | |
![[DIR]](/icons/folder.gif) | a-sweet-pastry-into-the-open-mout-fb1e11d6b3ccfd50/ | 2021-09-29 17:53 | - | |
![[TXT]](/icons/text.gif) | apricot-in-the-night-nap-dance-of- | 2021-09-29 07:44 | 539K | |
![[TXT]](/icons/text.gif) | apricot-in-the-night-nap-dance-of-5eeed5fb1710482d.html | 2021-10-06 07:44 | 538K | |
![[DIR]](/icons/folder.gif) | apricot-in-the-night-nap-dance-of-5eeed5fb1710482d/ | 2021-09-29 17:53 | - | |
![[IMG]](/icons/image2.gif) | artist-photo-web-1-2009-08-30T23_3 | 2021-09-29 07:44 | 94K | |
![[IMG]](/icons/image2.gif) | artist-photo-web-1-2009-08-30T23_33_24Z.jpg | 2021-10-06 07:44 | 94K | |
![[IMG]](/icons/image2.gif) | artist-photo-web.jpg | 2021-10-06 07:44 | 94K | |
![[TXT]](/icons/text.gif) | bell-ring-cricket-mt-fuji-and-a-p- | 2021-09-29 07:44 | 537K | |
![[TXT]](/icons/text.gif) | bell-ring-cricket-mt-fuji-and-a-p-11941b8bd2058851.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | bell-ring-cricket-mt-fuji-and-a-p-11941b8bd2058851/ | 2021-09-29 17:53 | - | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_2-web-1-2009-08- | 2021-09-29 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_2-web-1-2009-08-30T23_34_52Z.jpg | 2021-10-06 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_2-web.jpg | 2021-10-06 07:44 | 42K | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_3-web-1-2009-08- | 2021-09-29 07:44 | 48K | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_3-web-1-2009-08-30T23_35_08Z.jpg | 2021-10-06 07:44 | 48K | |
![[IMG]](/icons/image2.gif) | conder_1911_seals_3-web.jpg | 2021-10-06 07:44 | 48K | |
![[TXT]](/icons/text.gif) | depiction-of-demon-being-photogra- | 2021-09-29 07:44 | 541K | |
![[TXT]](/icons/text.gif) | depiction-of-demon-being-photogra-5ff8f12ae022166c.html | 2021-10-06 07:44 | 540K | |
![[DIR]](/icons/folder.gif) | depiction-of-demon-being-photogra-5ff8f12ae022166c/ | 2021-09-29 17:53 | - | |
![[TXT]](/icons/text.gif) | drumming-god-is-thunder-god-from-- | 2021-09-29 07:44 | 544K | |
![[TXT]](/icons/text.gif) | drumming-god-is-thunder-god-from--6cfb708bf850b4d5.html | 2021-10-06 07:44 | 543K | |
![[DIR]](/icons/folder.gif) | drumming-god-is-thunder-god-from--6cfb708bf850b4d5/ | 2021-09-29 17:53 | - | |
![[TXT]](/icons/text.gif) | flower-on-a-withered-tree-strolli- | 2021-09-29 07:44 | 540K | |
![[TXT]](/icons/text.gif) | flower-on-a-withered-tree-strolli-ef95451edb2e6f69.html | 2021-10-06 07:44 | 539K | |
![[DIR]](/icons/folder.gif) | flower-on-a-withered-tree-strolli-ef95451edb2e6f69/ | 2021-09-29 17:53 | - | |
![[IMG]](/icons/image2.gif) | gyosai-150x39-web.jpg | 2021-10-06 07:44 | 4.2K | |
![[TXT]](/icons/text.gif) | gyosai-gadan-anatomical-drawing-of | 2021-09-29 07:44 | 535K | |
![[TXT]](/icons/text.gif) | gyosai-gadan-anatomical-drawing-of-675848daf373ead.html | 2021-10-06 07:44 | 534K | |
![[DIR]](/icons/folder.gif) | gyosai-gadan-anatomical-drawing-of-675848daf373ead/ | 2021-09-29 17:53 | - | |
![[TXT]](/icons/text.gif) | gyosai-gadan-anatomical-drawing-of-rear-facing-man.html | 2021-10-06 07:44 | 534K | |
![[DIR]](/icons/folder.gif) | gyosai-gadan-anatomical-drawing-of-rear-facing-man/ | 2021-09-29 17:53 | - | |
![[TXT]](/icons/text.gif) | gyosai-gadan-laocoon-and-his-sons.html | 2021-10-06 07:44 | 534K | |
![[DIR]](/icons/folder.gif) | gyosai-gadan-laocoon-and-his-sons/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | gyosai-gadan-laocoon-and-his-sons_ | 2021-09-29 07:44 | 536K | |
![[TXT]](/icons/text.gif) | kyosai-gadan-drawing-based-on-pai- | 2021-09-29 07:44 | 537K | |
![[TXT]](/icons/text.gif) | kyosai-gadan-drawing-based-on-pai-e748a4d8d2dc300a.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | kyosai-gadan-drawing-based-on-pai-e748a4d8d2dc300a/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-akuji-senri-wo-hash | 2021-09-29 07:44 | 536K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-akuji-senri-wo-hashiru.html | 2021-10-06 07:44 | 535K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-akuji-senri-wo-hashiru/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-kappa-no-he.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-kappa-no-he/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-mi-no-naru-ki-wa-ha | 2021-09-29 07:45 | 540K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-mi-no-naru-ki-wa-hana-kara-shireru.html | 2021-10-06 07:44 | 539K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-mi-no-naru-ki-wa-hana-kara-shireru/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-ningen-banji-saio-- | 2021-09-29 07:45 | 539K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-ningen-banji-saio--86aa7f9df172b6a7.html | 2021-10-06 07:44 | 538K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-ningen-banji-saio--86aa7f9df172b6a7/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otafuku-ni-shiroza- | 2021-09-29 07:45 | 539K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otafuku-ni-shiroza-be7bfdfddec1274b.html | 2021-10-06 07:44 | 537K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-otafuku-ni-shiroza-be7bfdfddec1274b/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otsue-no-azuma-kuda | 2021-09-29 07:45 | 537K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otsue-no-azuma-kudari.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-otsue-no-azuma-kudari/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otsue-no-tawamure.h | 2021-09-29 07:45 | 540K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-otsue-no-tawamure.html | 2021-10-06 07:44 | 538K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-otsue-no-tawamure/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-saka-ni-kuruma-sen- | 2021-09-29 07:45 | 538K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-saka-ni-kuruma-sen-6775b5d63e9219b7.html | 2021-10-06 07:44 | 537K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-saka-ni-kuruma-sen-6775b5d63e9219b7/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-sho-no-daitengu.htm | 2021-09-29 07:45 | 538K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-sho-no-daitengu.html | 2021-10-06 07:44 | 537K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-sho-no-daitengu/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-soso.html | 2021-10-06 07:44 | 537K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-soso/ | 2021-09-29 17:54 | - | |
![[IMG]](/icons/image2.gif) | kyosai-hyakuzu-the-courtesan-of-e- | 2021-09-29 07:45 | 6.4K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-the-courtesan-of-e-1007e9200d4b4b3e.html | 2021-10-06 07:44 | 540K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-the-courtesan-of-e-1007e9200d4b4b3e/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-watonai-as-a-famous | 2021-09-29 07:45 | 543K | |
![[TXT]](/icons/text.gif) | kyosai-hyakuzu-watonai-as-a-famous-toymaker.html | 2021-10-06 07:44 | 542K | |
![[DIR]](/icons/folder.gif) | kyosai-hyakuzu-watonai-as-a-famous-toymaker/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | new-year-s-outing-before-a-suspens | 2021-09-29 07:45 | 536K | |
![[TXT]](/icons/text.gif) | new-year-s-outing-before-a-suspension-bridge.html | 2021-10-06 07:44 | 535K | |
![[DIR]](/icons/folder.gif) | new-year-s-outing-before-a-suspension-bridge/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | ofuku-coiffeur-holes-in-their-abd- | 2021-09-29 07:45 | 541K | |
![[TXT]](/icons/text.gif) | ofuku-coiffeur-holes-in-their-abd-686fbb2cd3f94f0e.html | 2021-10-06 07:44 | 540K | |
![[DIR]](/icons/folder.gif) | ofuku-coiffeur-holes-in-their-abd-686fbb2cd3f94f0e/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | print-congratulations-on-maritime- | 2021-09-29 07:45 | 537K | |
![[TXT]](/icons/text.gif) | print-congratulations-on-maritime-a2820758fc69eeeb.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | print-congratulations-on-maritime-a2820758fc69eeeb/ | 2021-09-29 17:54 | - | |
![[TXT]](/icons/text.gif) | putting-her-husband-under-her-beh- | 2021-09-29 07:45 | 544K | |
![[TXT]](/icons/text.gif) | putting-her-husband-under-her-beh-6ca8f5472ce3be01.html | 2021-10-06 07:44 | 542K | |
![[DIR]](/icons/folder.gif) | putting-her-husband-under-her-beh-6ca8f5472ce3be01/ | 2021-09-29 17:55 | - | |
![[TXT]](/icons/text.gif) | study-of-gaslight-and-silhouetted- | 2021-09-29 07:45 | 538K | |
![[TXT]](/icons/text.gif) | study-of-gaslight-and-silhouetted-figures.html | 2021-10-06 07:44 | 536K | |
![[DIR]](/icons/folder.gif) | study-of-gaslight-and-silhouetted-figures/ | 2021-09-29 17:55 | - | |
![[TXT]](/icons/text.gif) | the-seventh-month-suketakaya-taka- | 2021-09-29 07:45 | 535K | |
![[TXT]](/icons/text.gif) | the-seventh-month-suketakaya-taka-a5719e6602712bbc.html | 2021-10-06 07:44 | 534K | |
![[DIR]](/icons/folder.gif) | the-seventh-month-suketakaya-taka-a5719e6602712bbc/ | 2021-09-29 17:55 | - | |
![[IMG]](/icons/image2.gif) | unknown print bijutsusekai9ihl2531 | 2021-09-29 07:45 | 8.9K | |
![[IMG]](/icons/image2.gif) | unknown print bijutsusekai9ihl2531thumbweb.jpg | 2021-10-06 07:44 | 8.9K | |
![[TXT]](/icons/text.gif) | year-of-the-dragon-first-painting- | 2021-09-29 07:45 | 538K | |
![[TXT]](/icons/text.gif) | year-of-the-dragon-first-painting-449a2561441b3ac1.html | 2021-10-06 07:44 | 537K | |
![[DIR]](/icons/folder.gif) | year-of-the-dragon-first-painting-449a2561441b3ac1/ | 2021-09-29 17:55 | - | |
|